About bis(5-butylpyridine-2-carboxylic acid);manganese
bis(5-butylpyridine-2-carboxylic acid);manganese (PubChem CID 71594098) has the molecular formula C20H26MnN2O4
and a molecular weight of 413.38 g/mol. Its IUPAC name is bis(5-butylpyridine-2-carboxylic acid);manganese.
Molecular Properties
| Compound Name | bis(5-butylpyridine-2-carboxylic acid);manganese |
| PubChem CID | 71594098 |
| Molecular Formula | C20H26MnN2O4 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | bis(5-butylpyridine-2-carboxylic acid);manganese |
| SMILES | CCCCc1ccc(C(=O)O)nc1.CCCCc1ccc(C(=O)O)nc1.[Mn] |
| InChI | InChI=1S/2C10H13NO2.Mn/c2*1-2-3-4-8-5-6-9(10(12)13)11-7-8;/h2*5-7H,2-4H2,1H3,(H,12,13); |
| InChIKey | HJMDDEYRHDXTPU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(5-butylpyridine-2-carboxylic acid);manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-butylpyridine-2-carboxylic acid);manganese?
The IUPAC name of bis(5-butylpyridine-2-carboxylic acid);manganese (CID 71594098) is bis(5-butylpyridine-2-carboxylic acid);manganese.
What is the SMILES notation for bis(5-butylpyridine-2-carboxylic acid);manganese?
The canonical SMILES for bis(5-butylpyridine-2-carboxylic acid);manganese is CCCCc1ccc(C(=O)O)nc1.CCCCc1ccc(C(=O)O)nc1.[Mn].
What is the InChIKey of bis(5-butylpyridine-2-carboxylic acid);manganese?
The InChIKey is HJMDDEYRHDXTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13NO2.Mn/c2*1-2-3-4-8-5-6-9(10(12)13)11-7-8;/h2*5-7H,2-4H2,1H3,(H,12,13);.
What are the key properties of bis(5-butylpyridine-2-carboxylic acid);manganese?
bis(5-butylpyridine-2-carboxylic acid);manganese has a molecular weight of 413.38 g/mol, XLogP of 4.24, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-butylpyridine-2-carboxylic acid);manganese is sourced from PubChem (CID 71594098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).