C31H22FN5O3 — CID 71594548
[3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 71594548) has the molecular formula C31H22FN5O3 and a molecular weight of 531.55 g/mol. Its IUPAC name is [3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 71594548 |
| Molecular Formula | C31H22FN5O3 |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1N=C(c2ccc([N+](=O)[O-])cc2)CC1c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H22FN5O3/c32-24-15-11-22(12-16-24)30-27(20-35(34-30)25-9-5-2-6-10-25)29-19-28(21-13-17-26(18-14-21)37(39)40)33-36(29)31(38)23-7-3-1-4-8-23/h1-18,20,29H,19H2 |
| InChIKey | KRVXLABDENLEJJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|