C24H18FN5O2 — CID 71594555
3-(4-fluorophenyl)-4-[3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1-phenylpyrazole (PubChem CID 71594555) has the molecular formula C24H18FN5O2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1-phenylpyrazole.
| Compound Name | 3-(4-fluorophenyl)-4-[3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1-phenylpyrazole |
|---|---|
| PubChem CID | 71594555 |
| Molecular Formula | C24H18FN5O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[3-(3-nitrophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1-phenylpyrazole |
| SMILES | O=[N+]([O-])c1cccc(C2=NNC(c3cn(-c4ccccc4)nc3-c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C24H18FN5O2/c25-18-11-9-16(10-12-18)24-21(15-29(28-24)19-6-2-1-3-7-19)23-14-22(26-27-23)17-5-4-8-20(13-17)30(31)32/h1-13,15,23,27H,14H2 |
| InChIKey | BEXGYEVZDAACLU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|