C22H36O2 — CID 71594607
[(3R)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-yl] acetate (PubChem CID 71594607) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is [(3R)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-yl] acetate.
| Compound Name | [(3R)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 71594607 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | [(3R)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-yl] acetate |
| SMILES | C=C[C@@](C)(CC[C@H]1C(=C)CC[C@H]2C(C)(C)CCC[C@]12C)OC(C)=O |
| InChI | InChI=1S/C22H36O2/c1-8-21(6,24-17(3)23)15-12-18-16(2)10-11-19-20(4,5)13-9-14-22(18,19)7/h8,18-19H,1-2,9-15H2,3-7H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | YUDLAQPHRRNKDE-BLKABHOGSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|