C17H15N5OS2 — CID 71594615
1-[(E)-1-phenylethylideneamino]-3-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea (PubChem CID 71594615) has the molecular formula C17H15N5OS2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 1-[(E)-1-phenylethylideneamino]-3-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea.
| Compound Name | 1-[(E)-1-phenylethylideneamino]-3-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 71594615 |
| Molecular Formula | C17H15N5OS2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 1-[(E)-1-phenylethylideneamino]-3-[3-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]thiourea |
| SMILES | C/C(=N\NC(=S)Nc1cccc(-c2n[nH]c(=S)o2)c1)c1ccccc1 |
| InChI | InChI=1S/C17H15N5OS2/c1-11(12-6-3-2-4-7-12)19-21-16(24)18-14-9-5-8-13(10-14)15-20-22-17(25)23-15/h2-10H,1H3,(H,22,25)(H2,18,21,24)/b19-11+ |
| InChIKey | TXDVKFMTYFHKLQ-YBFXNURJSA-N |
| XLogP | 4.11 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|