C18H20N2O4 — CID 71594903
1,4-bis(2-hydroxyethylamino)-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 71594903) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1,4-bis(2-hydroxyethylamino)-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | 1,4-bis(2-hydroxyethylamino)-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 71594903 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1,4-bis(2-hydroxyethylamino)-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)C2C(NCCO)=CC=C(NCCO)C12 |
| InChI | InChI=1S/C18H20N2O4/c21-9-7-19-13-5-6-14(20-8-10-22)16-15(13)17(23)11-3-1-2-4-12(11)18(16)24/h1-6,15-16,19-22H,7-10H2 |
| InChIKey | DXFBPVJQYZURIB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|