About 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione
1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione (PubChem CID 71595202) has the molecular formula C11H16N5O6P
and a molecular weight of 345.25 g/mol. Its IUPAC name is 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione |
| PubChem CID | 71595202 |
| Molecular Formula | C11H16N5O6P |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)C(O)n1cc(-n2ccc(=O)[nH]c2=O)nn1 |
| InChI | InChI=1S/C11H16N5O6P/c1-3-21-23(20,22-4-2)11(19)16-7-8(13-14-16)15-6-5-9(17)12-10(15)18/h5-7,11,19H,3-4H2,1-2H3,(H,12,17,18) |
| InChIKey | MZWCAWYMBRPCNB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione?
The IUPAC name of 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione (CID 71595202) is 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione.
What is the SMILES notation for 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione?
The canonical SMILES for 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione is CCOP(=O)(OCC)C(O)n1cc(-n2ccc(=O)[nH]c2=O)nn1.
What is the InChIKey of 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione?
The InChIKey is MZWCAWYMBRPCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N5O6P/c1-3-21-23(20,22-4-2)11(19)16-7-8(13-14-16)15-6-5-9(17)12-10(15)18/h5-7,11,19H,3-4H2,1-2H3,(H,12,17,18).
What are the key properties of 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione?
1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione has a molecular weight of 345.25 g/mol, XLogP of -0.17, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[diethoxyphosphoryl(hydroxy)methyl]triazol-4-yl]pyrimidine-2,4-dione is sourced from PubChem (CID 71595202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).