C13H11CoN3O3S+2 — CID 71595687
cobalt(2+);N'-(4,5-dihydro-[1,3]benzodioxolo[5,6-e][1,3]benzothiazol-2-yl)-N-hydroxymethanimidamide (PubChem CID 71595687) has the molecular formula C13H11CoN3O3S+2 and a molecular weight of 348.25 g/mol. Its IUPAC name is cobalt(2+);N'-(4,5-dihydro-[1,3]benzodioxolo[5,6-e][1,3]benzothiazol-2-yl)-N-hydroxymethanimidamide.
| Compound Name | cobalt(2+);N'-(4,5-dihydro-[1,3]benzodioxolo[5,6-e][1,3]benzothiazol-2-yl)-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 71595687 |
| Molecular Formula | C13H11CoN3O3S+2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | cobalt(2+);N'-(4,5-dihydro-[1,3]benzodioxolo[5,6-e][1,3]benzothiazol-2-yl)-N-hydroxymethanimidamide |
| SMILES | ON/C=N\c1nc2c(s1)CCc1cc3c(cc1-2)OCO3.[Co+2] |
| InChI | InChI=1S/C13H11N3O3S.Co/c17-15-5-14-13-16-12-8-4-10-9(18-6-19-10)3-7(8)1-2-11(12)20-13;/h3-5,17H,1-2,6H2,(H,14,15,16);/q;+2 |
| InChIKey | QWWOPFBDNJDAJL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|