C25H28N2O3 — CID 71595693
[1-[(3,5-dimethylphenyl)methyl]-4-methoxyindol-3-yl]-[2-(1-hydroxyethenyl)pyrrolidin-1-yl]methanone (PubChem CID 71595693) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is [1-[(3,5-dimethylphenyl)methyl]-4-methoxyindol-3-yl]-[2-(1-hydroxyethenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-[(3,5-dimethylphenyl)methyl]-4-methoxyindol-3-yl]-[2-(1-hydroxyethenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71595693 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | [1-[(3,5-dimethylphenyl)methyl]-4-methoxyindol-3-yl]-[2-(1-hydroxyethenyl)pyrrolidin-1-yl]methanone |
| SMILES | C=C(O)C1CCCN1C(=O)c1cn(Cc2cc(C)cc(C)c2)c2cccc(OC)c12 |
| InChI | InChI=1S/C25H28N2O3/c1-16-11-17(2)13-19(12-16)14-26-15-20(24-22(26)7-5-9-23(24)30-4)25(29)27-10-6-8-21(27)18(3)28/h5,7,9,11-13,15,21,28H,3,6,8,10,14H2,1-2,4H3 |
| InChIKey | FVCJSOBLOXFWEA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|