C18H25N3 — CID 71596031
(3R,5S,9R,11S)-3,11-bis(but-3-ynyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596031) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is (3R,5S,9R,11S)-3,11-bis(but-3-ynyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | (3R,5S,9R,11S)-3,11-bis(but-3-ynyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596031 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (3R,5S,9R,11S)-3,11-bis(but-3-ynyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | C#CCC[C@@H]1C[C@@H]2CCC[C@@H]3C[C@H](CCC#C)NC(=N1)N32 |
| InChI | InChI=1S/C18H25N3/c1-3-5-8-14-12-16-10-7-11-17-13-15(9-6-4-2)20-18(19-14)21(16)17/h1-2,14-17H,5-13H2,(H,19,20)/t14-,15+,16+,17- |
| InChIKey | AGTKNBIOOKDLJR-ZYGGUILKSA-N |
| XLogP | 2.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|