About 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid
3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid (PubChem CID 71596168) has the molecular formula C18H18BrN3O2
and a molecular weight of 388.27 g/mol. Its IUPAC name is 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid |
| PubChem CID | 71596168 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid |
| SMILES | CCCCNc1c(-c2cccc(C(=O)O)c2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C18H18BrN3O2/c1-2-3-9-20-17-16(12-5-4-6-13(10-12)18(23)24)21-15-8-7-14(19)11-22(15)17/h4-8,10-11,20H,2-3,9H2,1H3,(H,23,24) |
| InChIKey | UWMJZRQANFLFMH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid?
The IUPAC name of 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid (CID 71596168) is 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid.
What is the SMILES notation for 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid?
The canonical SMILES for 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid is CCCCNc1c(-c2cccc(C(=O)O)c2)nc2ccc(Br)cn12.
What is the InChIKey of 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid?
The InChIKey is UWMJZRQANFLFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrN3O2/c1-2-3-9-20-17-16(12-5-4-6-13(10-12)18(23)24)21-15-8-7-14(19)11-22(15)17/h4-8,10-11,20H,2-3,9H2,1H3,(H,23,24).
What are the key properties of 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid?
3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid has a molecular weight of 388.27 g/mol, XLogP of 4.67, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-bromo-3-(butylamino)imidazo[1,2-a]pyridin-2-yl]benzoic acid is sourced from PubChem (CID 71596168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).