C17H27N3 — CID 71596227
(1R,4S,6R,10S)-6,10-bis(but-3-enyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene (PubChem CID 71596227) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6,10-bis(but-3-enyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene.
| Compound Name | (1R,4S,6R,10S)-6,10-bis(but-3-enyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
|---|---|
| PubChem CID | 71596227 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | (1R,4S,6R,10S)-6,10-bis(but-3-enyl)-7,9,12-triazatricyclo[6.3.1.04,12]dodec-7-ene |
| SMILES | C=CCC[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](CCC=C)NC(=N1)N32 |
| InChI | InChI=1S/C17H27N3/c1-3-5-7-13-11-15-9-10-16-12-14(8-6-4-2)19-17(18-13)20(15)16/h3-4,13-16H,1-2,5-12H2,(H,18,19)/t13-,14+,15+,16- |
| InChIKey | JLAOQVCTKQECKC-SYMSYNOKSA-N |
| XLogP | 3.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|