C20H18N4O6S2 — CID 71596264
1-amino-9,10-dioxo-4-(4-sulfamoylanilino)-4a,9a-dihydroanthracene-2-sulfonamide (PubChem CID 71596264) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-(4-sulfamoylanilino)-4a,9a-dihydroanthracene-2-sulfonamide.
| Compound Name | 1-amino-9,10-dioxo-4-(4-sulfamoylanilino)-4a,9a-dihydroanthracene-2-sulfonamide |
|---|---|
| PubChem CID | 71596264 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 1-amino-9,10-dioxo-4-(4-sulfamoylanilino)-4a,9a-dihydroanthracene-2-sulfonamide |
| SMILES | NC1=C(S(N)(=O)=O)C=C(Nc2ccc(S(N)(=O)=O)cc2)C2C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C20H18N4O6S2/c21-18-15(32(23,29)30)9-14(24-10-5-7-11(8-6-10)31(22,27)28)16-17(18)20(26)13-4-2-1-3-12(13)19(16)25/h1-9,16-17,24H,21H2,(H2,22,27,28)(H2,23,29,30) |
| InChIKey | GBLXDQRZFWTSSV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 192.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|