C17H29N3 — CID 71596436
11-methyl-3-(4-methylpent-3-enyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene (PubChem CID 71596436) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 11-methyl-3-(4-methylpent-3-enyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene.
| Compound Name | 11-methyl-3-(4-methylpent-3-enyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
|---|---|
| PubChem CID | 71596436 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 11-methyl-3-(4-methylpent-3-enyl)-2,12,13-triazatricyclo[7.3.1.05,13]tridec-1-ene |
| SMILES | CC(C)=CCCC1CC2CCCC3CC(C)NC(=N1)N23 |
| InChI | InChI=1S/C17H29N3/c1-12(2)6-4-7-14-11-16-9-5-8-15-10-13(3)18-17(19-14)20(15)16/h6,13-16H,4-5,7-11H2,1-3H3,(H,18,19) |
| InChIKey | YVWJYDWVBCJZBP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|