C22H19N3O3S3 — CID 71596668
(5E)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-bis(2-thiophen-2-ylethyl)imidazolidin-4-one (PubChem CID 71596668) has the molecular formula C22H19N3O3S3 and a molecular weight of 469.61 g/mol. Its IUPAC name is (5E)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-bis(2-thiophen-2-ylethyl)imidazolidin-4-one.
| Compound Name | (5E)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-bis(2-thiophen-2-ylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 71596668 |
| Molecular Formula | C22H19N3O3S3 |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (5E)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-bis(2-thiophen-2-ylethyl)imidazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccc([N+](=O)[O-])c2)N(CCc2cccs2)C(=S)N1CCc1cccs1 |
| InChI | InChI=1S/C22H19N3O3S3/c26-21-20(15-16-4-1-5-17(14-16)25(27)28)23(10-8-18-6-2-12-30-18)22(29)24(21)11-9-19-7-3-13-31-19/h1-7,12-15H,8-11H2/b20-15+ |
| InChIKey | GNQQBAGTUHXLKV-HMMYKYKNSA-N |
| XLogP | 4.97 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|