About methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate
methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate (PubChem CID 71596805) has the molecular formula C19H23N7O3
and a molecular weight of 397.44 g/mol. Its IUPAC name is methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate |
| PubChem CID | 71596805 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(N=C(N)N)cc(N=C(N)N)c1 |
| InChI | InChI=1S/C19H23N7O3/c1-29-17(28)15(7-11-5-3-2-4-6-11)26-16(27)12-8-13(24-18(20)21)10-14(9-12)25-19(22)23/h2-6,8-10,15H,7H2,1H3,(H,26,27)(H4,20,21,24)(H4,22,23,25)/t15-/m0/s1 |
| InChIKey | UJNIMVWUTZDGMI-HNNXBMFYSA-N |
| XLogP | 0.01 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate?
The IUPAC name of methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate (CID 71596805) is methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate.
What is the SMILES notation for methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate?
The canonical SMILES for methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate is COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(N=C(N)N)cc(N=C(N)N)c1.
What is the InChIKey of methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate?
The InChIKey is UJNIMVWUTZDGMI-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H23N7O3/c1-29-17(28)15(7-11-5-3-2-4-6-11)26-16(27)12-8-13(24-18(20)21)10-14(9-12)25-19(22)23/h2-6,8-10,15H,7H2,1H3,(H,26,27)(H4,20,21,24)(H4,22,23,25)/t15-/m0/s1.
What are the key properties of methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate?
methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate has a molecular weight of 397.44 g/mol, XLogP of 0.01, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[3,5-bis(diaminomethylideneamino)benzoyl]amino]-3-phenylpropanoate is sourced from PubChem (CID 71596805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).