About CID 71597138
CID 71597138 (PubChem CID 71597138) has the molecular formula C35H34N2O2
and a molecular weight of 514.67 g/mol.
Molecular Properties
| Compound Name | CID 71597138 |
| PubChem CID | 71597138 |
| Molecular Formula | C35H34N2O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccc(N3CCCCC3)cc2)[C@]2(CC3C=CC=CC3C2=O)[C@]12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C35H34N2O2/c1-36-22-30(23-15-17-26(18-16-23)37-19-5-2-6-20-37)34(21-25-9-3-4-12-27(25)32(34)38)35(36)29-14-8-11-24-10-7-13-28(31(24)29)33(35)39/h3-4,7-18,25,27,30H,2,5-6,19-22H2,1H3/t25?,27?,30-,34+,35+/m1/s1 |
| InChIKey | FOKPMTSUYFPOFY-GHJAGOMYSA-N |
| XLogP | 6.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze CID 71597138 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71597138?
The IUPAC name of CID 71597138 (CID 71597138) is not available.
What is the SMILES notation for CID 71597138?
The canonical SMILES for CID 71597138 is CN1C[C@H](c2ccc(N3CCCCC3)cc2)[C@]2(CC3C=CC=CC3C2=O)[C@]12C(=O)c1cccc3cccc2c13.
What is the InChIKey of CID 71597138?
The InChIKey is FOKPMTSUYFPOFY-GHJAGOMYSA-N. The full InChI is InChI=1S/C35H34N2O2/c1-36-22-30(23-15-17-26(18-16-23)37-19-5-2-6-20-37)34(21-25-9-3-4-12-27(25)32(34)38)35(36)29-14-8-11-24-10-7-13-28(31(24)29)33(35)39/h3-4,7-18,25,27,30H,2,5-6,19-22H2,1H3/t25?,27?,30-,34+,35+/m1/s1.
What are the key properties of CID 71597138?
CID 71597138 has a molecular weight of 514.67 g/mol, XLogP of 6.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71597138 is sourced from PubChem (CID 71597138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).