C10H8N4S — CID 71597250
5,10-dihydro-2H-[1,2,4]triazino[5,6-b]quinoline-3-thione (PubChem CID 71597250) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 5,10-dihydro-2H-[1,2,4]triazino[5,6-b]quinoline-3-thione.
| Compound Name | 5,10-dihydro-2H-[1,2,4]triazino[5,6-b]quinoline-3-thione |
|---|---|
| PubChem CID | 71597250 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5,10-dihydro-2H-[1,2,4]triazino[5,6-b]quinoline-3-thione |
| SMILES | S=c1nc2c(n[nH]1)Cc1ccccc1N2 |
| InChI | InChI=1S/C10H8N4S/c15-10-12-9-8(13-14-10)5-6-3-1-2-4-7(6)11-9/h1-4H,5H2,(H2,11,12,14,15) |
| InChIKey | XVQAIAUFSDRYIX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|