About bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate
bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate (PubChem CID 71597283) has the molecular formula C31H21N5O4
and a molecular weight of 527.54 g/mol. Its IUPAC name is bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate |
| PubChem CID | 71597283 |
| Molecular Formula | C31H21N5O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])n1.c1cnc2c(c1)ccc1ccc[nH+]c12.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/2C12H8N2.C7H5NO4/c2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-6(10)4-2-1-3-5(8-4)7(11)12/h2*1-8H;1-3H,(H,9,10)(H,11,12) |
| InChIKey | QVKVAAFIBAAPDZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 147.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate?
The IUPAC name of bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate (CID 71597283) is bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate.
What is the SMILES notation for bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate?
The canonical SMILES for bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate is O=C([O-])c1cccc(C(=O)[O-])n1.c1cnc2c(c1)ccc1ccc[nH+]c12.c1cnc2c(c1)ccc1ccc[nH+]c12.
What is the InChIKey of bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate?
The InChIKey is QVKVAAFIBAAPDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H8N2.C7H5NO4/c2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;9-6(10)4-2-1-3-5(8-4)7(11)12/h2*1-8H;1-3H,(H,9,10)(H,11,12).
What are the key properties of bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate?
bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate has a molecular weight of 527.54 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,10-phenanthrolin-10-ium);pyridine-2,6-dicarboxylate is sourced from PubChem (CID 71597283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).