C17H16N4O3 — CID 71597386
2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetohydrazide (PubChem CID 71597386) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetohydrazide.
| Compound Name | 2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 71597386 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(2,4-dioxo-5,5-diphenylimidazolidin-1-yl)acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)NC(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c18-20-14(22)11-21-16(24)19-15(23)17(21,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11,18H2,(H,20,22)(H,19,23,24) |
| InChIKey | WNYMQINIIOTDDQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|