C15H17N3O — CID 71597456
cyclohex-3-en-1-yl-(3-phenyl-1H-1,2,4-triazol-5-yl)methanol (PubChem CID 71597456) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(3-phenyl-1H-1,2,4-triazol-5-yl)methanol.
| Compound Name | cyclohex-3-en-1-yl-(3-phenyl-1H-1,2,4-triazol-5-yl)methanol |
|---|---|
| PubChem CID | 71597456 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | cyclohex-3-en-1-yl-(3-phenyl-1H-1,2,4-triazol-5-yl)methanol |
| SMILES | OC(c1nc(-c2ccccc2)n[nH]1)C1CC=CCC1 |
| InChI | InChI=1S/C15H17N3O/c19-13(11-7-3-1-4-8-11)15-16-14(17-18-15)12-9-5-2-6-10-12/h1-3,5-6,9-11,13,19H,4,7-8H2,(H,16,17,18) |
| InChIKey | ZUFOXHZCDSGQOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|