About 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid
1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid (PubChem CID 71597501) has the molecular formula C18H15F3NO4S2+
and a molecular weight of 430.45 g/mol. Its IUPAC name is 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid |
| PubChem CID | 71597501 |
| Molecular Formula | C18H15F3NO4S2+ |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid |
| SMILES | COc1cccc2c1cc1sc3ccccc3c1[n+]2C.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C17H14NOS.CHF3O3S/c1-18-13-7-5-8-14(19-2)12(13)10-16-17(18)11-6-3-4-9-15(11)20-16;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1; |
| InChIKey | SFUOYSTYXZRLBJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid?
The IUPAC name of 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid (CID 71597501) is 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid?
The canonical SMILES for 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid is COc1cccc2c1cc1sc3ccccc3c1[n+]2C.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid?
The InChIKey is SFUOYSTYXZRLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14NOS.CHF3O3S/c1-18-13-7-5-8-14(19-2)12(13)10-16-17(18)11-6-3-4-9-15(11)20-16;2-1(3,4)8(5,6)7/h3-10H,1-2H3;(H,5,6,7)/q+1;.
What are the key properties of 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid?
1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid has a molecular weight of 430.45 g/mol, XLogP of 4.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium;trifluoromethanesulfonic acid is sourced from PubChem (CID 71597501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).