C21H15N7O3S — CID 71597753
6-methoxy-N-[3-(4-nitrophenyl)-5-pyridin-3-yl-1,2,4-triazol-4-yl]-1,3-benzothiazol-2-amine (PubChem CID 71597753) has the molecular formula C21H15N7O3S and a molecular weight of 445.46 g/mol. Its IUPAC name is 6-methoxy-N-[3-(4-nitrophenyl)-5-pyridin-3-yl-1,2,4-triazol-4-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-methoxy-N-[3-(4-nitrophenyl)-5-pyridin-3-yl-1,2,4-triazol-4-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 71597753 |
| Molecular Formula | C21H15N7O3S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 6-methoxy-N-[3-(4-nitrophenyl)-5-pyridin-3-yl-1,2,4-triazol-4-yl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nn3c(-c4ccc([N+](=O)[O-])cc4)nnc3-c3cccnc3)sc2c1 |
| InChI | InChI=1S/C21H15N7O3S/c1-31-16-8-9-17-18(11-16)32-21(23-17)26-27-19(13-4-6-15(7-5-13)28(29)30)24-25-20(27)14-3-2-10-22-12-14/h2-12H,1H3,(H,23,26) |
| InChIKey | UOYXXTMUNWEIAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|