About N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide
N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide (PubChem CID 7159804) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide |
| PubChem CID | 7159804 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H](C)C=C(C#N)O1 |
| InChI | InChI=1S/C9H12N2O2/c1-6-3-8(5-10)13-9(4-6)11-7(2)12/h3,6,9H,4H2,1-2H3,(H,11,12)/t6-,9+/m1/s1 |
| InChIKey | WYZDSZOHRGRRDZ-MUWHJKNJSA-N |
| XLogP | 0.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide?
The IUPAC name of N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide (CID 7159804) is N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide.
What is the SMILES notation for N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide?
The canonical SMILES for N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide is CC(=O)N[C@@H]1C[C@H](C)C=C(C#N)O1.
What is the InChIKey of N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide?
The InChIKey is WYZDSZOHRGRRDZ-MUWHJKNJSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-6-3-8(5-10)13-9(4-6)11-7(2)12/h3,6,9H,4H2,1-2H3,(H,11,12)/t6-,9+/m1/s1.
What are the key properties of N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide?
N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide has a molecular weight of 180.21 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,4S)-6-cyano-4-methyl-3,4-dihydro-2H-pyran-2-yl]acetamide is sourced from PubChem (CID 7159804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).