C17H24N2O3 — CID 71598175
benzyl N-[(E,4S)-6-methyl-1-(methylamino)-1-oxohept-2-en-4-yl]carbamate (PubChem CID 71598175) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl N-[(E,4S)-6-methyl-1-(methylamino)-1-oxohept-2-en-4-yl]carbamate.
| Compound Name | benzyl N-[(E,4S)-6-methyl-1-(methylamino)-1-oxohept-2-en-4-yl]carbamate |
|---|---|
| PubChem CID | 71598175 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | benzyl N-[(E,4S)-6-methyl-1-(methylamino)-1-oxohept-2-en-4-yl]carbamate |
| SMILES | CNC(=O)/C=C/[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3/c1-13(2)11-15(9-10-16(20)18-3)19-17(21)22-12-14-7-5-4-6-8-14/h4-10,13,15H,11-12H2,1-3H3,(H,18,20)(H,19,21)/b10-9+/t15-/m1/s1 |
| InChIKey | COCGKRBJIXTFFH-BOLDSZDNSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|