C20H11NO3 — CID 71598222
20-hydroxy-10-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene-2,12-dione (PubChem CID 71598222) has the molecular formula C20H11NO3 and a molecular weight of 313.31 g/mol. Its IUPAC name is 20-hydroxy-10-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene-2,12-dione.
| Compound Name | 20-hydroxy-10-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene-2,12-dione |
|---|---|
| PubChem CID | 71598222 |
| Molecular Formula | C20H11NO3 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 20-hydroxy-10-azapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14,16,18,20-nonaene-2,12-dione |
| SMILES | O=C1c2cc(O)c3ccccc3c2C(=O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C20H11NO3/c22-15-9-13-16(11-6-2-1-5-10(11)15)20(24)18-17(19(13)23)12-7-3-4-8-14(12)21-18/h1-9,21-22H |
| InChIKey | KJKPJLPMCQRJEE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|