C15H18N4O2 — CID 71598231
2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)-N-[(E)-1-phenylethylideneamino]acetamide (PubChem CID 71598231) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)-N-[(E)-1-phenylethylideneamino]acetamide.
| Compound Name | 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)-N-[(E)-1-phenylethylideneamino]acetamide |
|---|---|
| PubChem CID | 71598231 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(3-methyl-6-oxo-4,5-dihydropyridazin-1-yl)-N-[(E)-1-phenylethylideneamino]acetamide |
| SMILES | CC1=NN(CC(=O)N/N=C(\C)c2ccccc2)C(=O)CC1 |
| InChI | InChI=1S/C15H18N4O2/c1-11-8-9-15(21)19(18-11)10-14(20)17-16-12(2)13-6-4-3-5-7-13/h3-7H,8-10H2,1-2H3,(H,17,20)/b16-12+ |
| InChIKey | CCTJDTCPKWZARB-FOWTUZBSSA-N |
| XLogP | 1.53 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|