C26H39N3O5 — CID 71598351
tert-butyl N-[(2S)-4-methyl-1-[[(E,2S)-5-morpholin-4-yl-5-oxo-1-phenylpent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 71598351) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-methyl-1-[[(E,2S)-5-morpholin-4-yl-5-oxo-1-phenylpent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-methyl-1-[[(E,2S)-5-morpholin-4-yl-5-oxo-1-phenylpent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 71598351 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | tert-butyl N-[(2S)-4-methyl-1-[[(E,2S)-5-morpholin-4-yl-5-oxo-1-phenylpent-3-en-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](/C=C/C(=O)N1CCOCC1)Cc1ccccc1 |
| InChI | InChI=1S/C26H39N3O5/c1-19(2)17-22(28-25(32)34-26(3,4)5)24(31)27-21(18-20-9-7-6-8-10-20)11-12-23(30)29-13-15-33-16-14-29/h6-12,19,21-22H,13-18H2,1-5H3,(H,27,31)(H,28,32)/b12-11+/t21-,22+/m1/s1 |
| InChIKey | CGZUNLIVEZBMBH-LVIAPQIJSA-N |
| XLogP | 3.07 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|