C25H27ClN8O2 — CID 71598367
4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-methoxyphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 71598367) has the molecular formula C25H27ClN8O2 and a molecular weight of 507.00 g/mol. Its IUPAC name is 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-methoxyphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-methoxyphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71598367 |
| Molecular Formula | C25H27ClN8O2 |
| Molecular Weight | 507.00 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-methoxyphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NCCNc3ccnc4cc(Cl)ccc34)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C25H27ClN8O2/c1-35-19-5-3-18(4-6-19)30-24-31-23(32-25(33-24)34-12-14-36-15-13-34)29-11-10-28-21-8-9-27-22-16-17(26)2-7-20(21)22/h2-9,16H,10-15H2,1H3,(H,27,28)(H2,29,30,31,32,33) |
| InChIKey | JELWGCYPUDLHJQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.00 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|