About benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate
benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate (PubChem CID 71598512) has the molecular formula C21H30N2O3
and a molecular weight of 358.48 g/mol. Its IUPAC name is benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate |
| PubChem CID | 71598512 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/C(=O)N1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O3/c1-17(2)15-19(11-12-20(24)23-13-7-4-8-14-23)22-21(25)26-16-18-9-5-3-6-10-18/h3,5-6,9-12,17,19H,4,7-8,13-16H2,1-2H3,(H,22,25)/b12-11+/t19-/m1/s1 |
| InChIKey | WGJWGNKCVHJEAE-TZZQJPOUSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate?
The IUPAC name of benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate (CID 71598512) is benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate.
What is the SMILES notation for benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate?
The canonical SMILES for benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate is CC(C)C[C@@H](/C=C/C(=O)N1CCCCC1)NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate?
The InChIKey is WGJWGNKCVHJEAE-TZZQJPOUSA-N. The full InChI is InChI=1S/C21H30N2O3/c1-17(2)15-19(11-12-20(24)23-13-7-4-8-14-23)22-21(25)26-16-18-9-5-3-6-10-18/h3,5-6,9-12,17,19H,4,7-8,13-16H2,1-2H3,(H,22,25)/b12-11+/t19-/m1/s1.
What are the key properties of benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate?
benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate has a molecular weight of 358.48 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(E,4S)-6-methyl-1-oxo-1-piperidin-1-ylhept-2-en-4-yl]carbamate is sourced from PubChem (CID 71598512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).