C32H44N2O3 — CID 71598542
(3S)-3-[(1R)-2-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-1-hydroxyethyl]-4-azabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-one (PubChem CID 71598542) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is (3S)-3-[(1R)-2-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-1-hydroxyethyl]-4-azabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-one.
| Compound Name | (3S)-3-[(1R)-2-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-1-hydroxyethyl]-4-azabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-one |
|---|---|
| PubChem CID | 71598542 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | (3S)-3-[(1R)-2-[[(4S)-6-ethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-1-hydroxyethyl]-4-azabicyclo[11.3.1]heptadeca-1(16),13(17),14-trien-5-one |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@@H]1Cc3cccc(c3)CCCCCCCC(=O)N1)CC1(CCC1)O2 |
| InChI | InChI=1S/C32H44N2O3/c1-2-23-14-15-30-26(19-23)28(21-32(37-30)16-9-17-32)33-22-29(35)27-20-25-12-8-11-24(18-25)10-6-4-3-5-7-13-31(36)34-27/h8,11-12,14-15,18-19,27-29,33,35H,2-7,9-10,13,16-17,20-22H2,1H3,(H,34,36)/t27-,28-,29+/m0/s1 |
| InChIKey | QPAQZVPVDCXNCF-YTCPBCGMSA-N |
| XLogP | 5.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |