C24H25N5O4 — CID 71599062
N'-hydroxy-2-[4-[1-[(E)-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenoxy]ethanimidamide (PubChem CID 71599062) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N'-hydroxy-2-[4-[1-[(E)-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenoxy]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-[1-[(E)-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenoxy]ethanimidamide |
|---|---|
| PubChem CID | 71599062 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N'-hydroxy-2-[4-[1-[(E)-3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-3-yl)prop-2-enoyl]-3,6-dihydro-2H-pyridin-4-yl]phenoxy]ethanimidamide |
| SMILES | N/C(COc1ccc(C2=CCN(C(=O)/C=C/c3cnc4c(c3)CCC(=O)N4)CC2)cc1)=N\O |
| InChI | InChI=1S/C24H25N5O4/c25-21(28-32)15-33-20-5-2-17(3-6-20)18-9-11-29(12-10-18)23(31)8-1-16-13-19-4-7-22(30)27-24(19)26-14-16/h1-3,5-6,8-9,13-14,32H,4,7,10-12,15H2,(H2,25,28)(H,26,27,30)/b8-1+ |
| InChIKey | HXFZLASJXJXOSC-UNXLUWIOSA-N |
| XLogP | 2.42 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|