C20H21BClF2N3O3 — CID 71599547
[1-[(3-chloro-2-methylphenyl)methyl]-2-(difluoromethyl)-6-morpholin-4-ylbenzimidazol-4-yl]boronic acid (PubChem CID 71599547) has the molecular formula C20H21BClF2N3O3 and a molecular weight of 435.67 g/mol. Its IUPAC name is [1-[(3-chloro-2-methylphenyl)methyl]-2-(difluoromethyl)-6-morpholin-4-ylbenzimidazol-4-yl]boronic acid.
| Compound Name | [1-[(3-chloro-2-methylphenyl)methyl]-2-(difluoromethyl)-6-morpholin-4-ylbenzimidazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 71599547 |
| Molecular Formula | C20H21BClF2N3O3 |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [1-[(3-chloro-2-methylphenyl)methyl]-2-(difluoromethyl)-6-morpholin-4-ylbenzimidazol-4-yl]boronic acid |
| SMILES | Cc1c(Cl)cccc1Cn1c(C(F)F)nc2c(B(O)O)cc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C20H21BClF2N3O3/c1-12-13(3-2-4-16(12)22)11-27-17-10-14(26-5-7-30-8-6-26)9-15(21(28)29)18(17)25-20(27)19(23)24/h2-4,9-10,19,28-29H,5-8,11H2,1H3 |
| InChIKey | BECCQFJKXBVKIC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|