C30H25F4N5O4S — CID 71599642
(2R)-2-(4-fluorophenyl)-N-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide (PubChem CID 71599642) has the molecular formula C30H25F4N5O4S and a molecular weight of 627.62 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-N-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide.
| Compound Name | (2R)-2-(4-fluorophenyl)-N-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 71599642 |
| Molecular Formula | C30H25F4N5O4S |
| Molecular Weight | 627.62 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-N-[4-[2-[4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(-c2ccc3nc(Nc4ccc(S(C)(=O)=O)cc4OCC(F)(F)F)nn3c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H25F4N5O4S/c1-18(19-3-8-22(31)9-4-19)28(40)35-23-10-5-20(6-11-23)21-7-14-27-37-29(38-39(27)16-21)36-25-13-12-24(44(2,41)42)15-26(25)43-17-30(32,33)34/h3-16,18H,17H2,1-2H3,(H,35,40)(H,36,38)/t18-/m1/s1 |
| InChIKey | VYJXPBPEYOOMNE-GOSISDBHSA-N |
| XLogP | 6.37 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |