C21H22F2N4O2 — CID 71599938
5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(2-methoxyethyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 71599938) has the molecular formula C21H22F2N4O2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(2-methoxyethyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(2-methoxyethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71599938 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-N-(2-methoxyethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cnn2ccc(N3CCC[C@@H]3c3cc(F)ccc3F)cc12 |
| InChI | InChI=1S/C21H22F2N4O2/c1-29-10-7-24-21(28)17-13-25-27-9-6-15(12-20(17)27)26-8-2-3-19(26)16-11-14(22)4-5-18(16)23/h4-6,9,11-13,19H,2-3,7-8,10H2,1H3,(H,24,28)/t19-/m1/s1 |
| InChIKey | FEFXDSPBFBYQNL-LJQANCHMSA-N |
| XLogP | 3.33 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|