About (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile
(2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile (PubChem CID 7159996) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile.
Molecular Properties
| Compound Name | (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile |
| PubChem CID | 7159996 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile |
| SMILES | CCO[C@@H]1OC(C#N)=CC[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O4/c1-2-13-8-7(10(11)12)4-3-6(5-9)14-8/h3,7-8H,2,4H2,1H3/t7-,8+/m0/s1 |
| InChIKey | CGZCNPZYSHLBKY-JGVFFNPUSA-N |
| XLogP | 0.82 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile?
The IUPAC name of (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile (CID 7159996) is (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile.
What is the SMILES notation for (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile?
The canonical SMILES for (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile is CCO[C@@H]1OC(C#N)=CC[C@@H]1[N+](=O)[O-].
What is the InChIKey of (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile?
The InChIKey is CGZCNPZYSHLBKY-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-2-13-8-7(10(11)12)4-3-6(5-9)14-8/h3,7-8H,2,4H2,1H3/t7-,8+/m0/s1.
What are the key properties of (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile?
(2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile has a molecular weight of 198.18 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-ethoxy-3-nitro-3,4-dihydro-2H-pyran-6-carbonitrile is sourced from PubChem (CID 7159996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).