C23H44O3Si — CID 71600181
ethyl (4E,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyltetradeca-4,6-dienoate (PubChem CID 71600181) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is ethyl (4E,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyltetradeca-4,6-dienoate.
| Compound Name | ethyl (4E,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyltetradeca-4,6-dienoate |
|---|---|
| PubChem CID | 71600181 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | ethyl (4E,6Z)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyltetradeca-4,6-dienoate |
| SMILES | CCCCCCC/C=C\C=C(/C)C(CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-9-11-12-13-14-15-16-17-18-20(3)21(19-22(24)25-10-2)26-27(7,8)23(4,5)6/h16-18,21H,9-15,19H2,1-8H3/b17-16-,20-18+ |
| InChIKey | FFNARQXOOSVFLE-ZTVQAUPKSA-N |
| XLogP | 7.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|