About 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione
1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 71600329) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione.
Molecular Properties
| Compound Name | 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione |
| PubChem CID | 71600329 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(C)cc1C(=O)C(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C12H14N4O2/c1-7-9(5-15(3)13-7)11(17)12(18)10-6-16(4)14-8(10)2/h5-6H,1-4H3 |
| InChIKey | SUDASRQTHLQYAQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione?
The IUPAC name of 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione (CID 71600329) is 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione.
What is the SMILES notation for 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione?
The canonical SMILES for 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione is Cc1nn(C)cc1C(=O)C(=O)c1cn(C)nc1C.
What is the InChIKey of 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione?
The InChIKey is SUDASRQTHLQYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-7-9(5-15(3)13-7)11(17)12(18)10-6-16(4)14-8(10)2/h5-6H,1-4H3.
What are the key properties of 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione?
1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione has a molecular weight of 246.27 g/mol, XLogP of 0.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(1,3-dimethylpyrazol-4-yl)ethane-1,2-dione is sourced from PubChem (CID 71600329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).