C34H35NO8 — CID 71600357
[4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]-2-methoxyphenyl] 5-phenyl-1,2-oxazole-3-carboxylate (PubChem CID 71600357) has the molecular formula C34H35NO8 and a molecular weight of 585.65 g/mol. Its IUPAC name is [4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]-2-methoxyphenyl] 5-phenyl-1,2-oxazole-3-carboxylate.
| Compound Name | [4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]-2-methoxyphenyl] 5-phenyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 71600357 |
| Molecular Formula | C34H35NO8 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | [4-[bis(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl]-2-methoxyphenyl] 5-phenyl-1,2-oxazole-3-carboxylate |
| SMILES | COc1cc(C(C2=C(O)CC(C)(C)CC2=O)C2=C(O)CC(C)(C)CC2=O)ccc1OC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C34H35NO8/c1-33(2)15-22(36)30(23(37)16-33)29(31-24(38)17-34(3,4)18-25(31)39)20-11-12-26(28(13-20)41-5)42-32(40)21-14-27(43-35-21)19-9-7-6-8-10-19/h6-14,29,36,38H,15-18H2,1-5H3 |
| InChIKey | BBPRJXTXYVUDAV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|