About 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone
1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone (PubChem CID 71600610) has the molecular formula C20H20O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone |
| PubChem CID | 71600610 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)C(C(C)=O)=C2C |
| InChI | InChI=1S/C20H20O3/c1-12-15-10-17(22-3)18(23-4)11-16(15)20(19(12)13(2)21)14-8-6-5-7-9-14/h5-11,20H,1-4H3 |
| InChIKey | ZCLHSAZBGDXHNJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone?
The IUPAC name of 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone (CID 71600610) is 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone.
What is the SMILES notation for 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone?
The canonical SMILES for 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone is COc1cc2c(cc1OC)C(c1ccccc1)C(C(C)=O)=C2C.
What is the InChIKey of 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone?
The InChIKey is ZCLHSAZBGDXHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O3/c1-12-15-10-17(22-3)18(23-4)11-16(15)20(19(12)13(2)21)14-8-6-5-7-9-14/h5-11,20H,1-4H3.
What are the key properties of 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone?
1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone has a molecular weight of 308.38 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethoxy-3-methyl-1-phenyl-1H-inden-2-yl)ethanone is sourced from PubChem (CID 71600610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).