C20H16N2O4 — CID 71601086
6-(3-aminopropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylic acid (PubChem CID 71601086) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-(3-aminopropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylic acid.
| Compound Name | 6-(3-aminopropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71601086 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(3-aminopropyl)-5,11-dioxoindeno[1,2-c]isoquinoline-3-carboxylic acid |
| SMILES | NCCCn1c2c(c3ccc(C(=O)O)cc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H16N2O4/c21-8-3-9-22-17-13-4-1-2-5-14(13)18(23)16(17)12-7-6-11(20(25)26)10-15(12)19(22)24/h1-2,4-7,10H,3,8-9,21H2,(H,25,26) |
| InChIKey | LCXVMMOECQMSNQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|