About 3-bromoindeno[1,2-c]isochromene-5,11-dione
3-bromoindeno[1,2-c]isochromene-5,11-dione (PubChem CID 71601089) has the molecular formula C16H7BrO3
and a molecular weight of 327.13 g/mol. Its IUPAC name is 3-bromoindeno[1,2-c]isochromene-5,11-dione.
Molecular Properties
| Compound Name | 3-bromoindeno[1,2-c]isochromene-5,11-dione |
| PubChem CID | 71601089 |
| Molecular Formula | C16H7BrO3 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 3-bromoindeno[1,2-c]isochromene-5,11-dione |
| SMILES | O=C1c2ccccc2-c2oc(=O)c3cc(Br)ccc3c21 |
| InChI | InChI=1S/C16H7BrO3/c17-8-5-6-9-12(7-8)16(19)20-15-11-4-2-1-3-10(11)14(18)13(9)15/h1-7H |
| InChIKey | GWVCXTIBWBGXQY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromoindeno[1,2-c]isochromene-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoindeno[1,2-c]isochromene-5,11-dione?
The IUPAC name of 3-bromoindeno[1,2-c]isochromene-5,11-dione (CID 71601089) is 3-bromoindeno[1,2-c]isochromene-5,11-dione.
What is the SMILES notation for 3-bromoindeno[1,2-c]isochromene-5,11-dione?
The canonical SMILES for 3-bromoindeno[1,2-c]isochromene-5,11-dione is O=C1c2ccccc2-c2oc(=O)c3cc(Br)ccc3c21.
What is the InChIKey of 3-bromoindeno[1,2-c]isochromene-5,11-dione?
The InChIKey is GWVCXTIBWBGXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7BrO3/c17-8-5-6-9-12(7-8)16(19)20-15-11-4-2-1-3-10(11)14(18)13(9)15/h1-7H.
What are the key properties of 3-bromoindeno[1,2-c]isochromene-5,11-dione?
3-bromoindeno[1,2-c]isochromene-5,11-dione has a molecular weight of 327.13 g/mol, XLogP of 3.77, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoindeno[1,2-c]isochromene-5,11-dione is sourced from PubChem (CID 71601089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).