About 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide
5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 71601544) has the molecular formula C11H12N4O3
and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| PubChem CID | 71601544 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)NO)=NN1c1ccccc1 |
| InChI | InChI=1S/C11H12N4O3/c12-10(16)9-6-8(11(17)14-18)13-15(9)7-4-2-1-3-5-7/h1-5,9,18H,6H2,(H2,12,16)(H,14,17) |
| InChIKey | YETHZGPYTYHDEC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The IUPAC name of 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (CID 71601544) is 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
What is the SMILES notation for 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The canonical SMILES for 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide is NC(=O)C1CC(C(=O)NO)=NN1c1ccccc1.
What is the InChIKey of 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
The InChIKey is YETHZGPYTYHDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3/c12-10(16)9-6-8(11(17)14-18)13-15(9)7-4-2-1-3-5-7/h1-5,9,18H,6H2,(H2,12,16)(H,14,17).
What are the key properties of 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide?
5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide has a molecular weight of 248.24 g/mol, XLogP of -0.39, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-hydroxy-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide is sourced from PubChem (CID 71601544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).