C24H30N4O4Si — CID 71601691
N-[(1R)-6-[7-formyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxy-2,3-dihydro-1H-inden-1-yl]acetamide (PubChem CID 71601691) has the molecular formula C24H30N4O4Si and a molecular weight of 466.61 g/mol. Its IUPAC name is N-[(1R)-6-[7-formyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxy-2,3-dihydro-1H-inden-1-yl]acetamide.
| Compound Name | N-[(1R)-6-[7-formyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxy-2,3-dihydro-1H-inden-1-yl]acetamide |
|---|---|
| PubChem CID | 71601691 |
| Molecular Formula | C24H30N4O4Si |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[(1R)-6-[7-formyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]oxy-2,3-dihydro-1H-inden-1-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCc2ccc(Oc3cnc4c(n3)c(C=O)cn4COCC[Si](C)(C)C)cc21 |
| InChI | InChI=1S/C24H30N4O4Si/c1-16(30)26-21-8-6-17-5-7-19(11-20(17)21)32-22-12-25-24-23(27-22)18(14-29)13-28(24)15-31-9-10-33(2,3)4/h5,7,11-14,21H,6,8-10,15H2,1-4H3,(H,26,30)/t21-/m1/s1 |
| InChIKey | IOKVXJOPLZISLI-OAQYLSRUSA-N |
| XLogP | 4.47 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|