About 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole
1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole (PubChem CID 71601807) has the molecular formula C18H17ClN2O
and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole.
Molecular Properties
| Compound Name | 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole |
| PubChem CID | 71601807 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole |
| SMILES | Cc1cc(Oc2cccc(Cn3ccnc3)c2)cc(C)c1Cl |
| InChI | InChI=1S/C18H17ClN2O/c1-13-8-17(9-14(2)18(13)19)22-16-5-3-4-15(10-16)11-21-7-6-20-12-21/h3-10,12H,11H2,1-2H3 |
| InChIKey | KRDUMXYLMIWMMP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole?
The IUPAC name of 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole (CID 71601807) is 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole.
What is the SMILES notation for 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole?
The canonical SMILES for 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole is Cc1cc(Oc2cccc(Cn3ccnc3)c2)cc(C)c1Cl.
What is the InChIKey of 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole?
The InChIKey is KRDUMXYLMIWMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O/c1-13-8-17(9-14(2)18(13)19)22-16-5-3-4-15(10-16)11-21-7-6-20-12-21/h3-10,12H,11H2,1-2H3.
What are the key properties of 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole?
1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole has a molecular weight of 312.80 g/mol, XLogP of 4.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]imidazole is sourced from PubChem (CID 71601807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).