About 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone
2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone (PubChem CID 71601990) has the molecular formula C18H18FN5O
and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone.
Molecular Properties
| Compound Name | 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone |
| PubChem CID | 71601990 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone |
| SMILES | O=C(CN1CCN(c2ccc(F)cn2)CC1)c1cnn2ccccc12 |
| InChI | InChI=1S/C18H18FN5O/c19-14-4-5-18(20-11-14)23-9-7-22(8-10-23)13-17(25)15-12-21-24-6-2-1-3-16(15)24/h1-6,11-12H,7-10,13H2 |
| InChIKey | SHXRSSWYCNXYBM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone?
The IUPAC name of 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone (CID 71601990) is 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone.
What is the SMILES notation for 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone?
The canonical SMILES for 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone is O=C(CN1CCN(c2ccc(F)cn2)CC1)c1cnn2ccccc12.
What is the InChIKey of 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone?
The InChIKey is SHXRSSWYCNXYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN5O/c19-14-4-5-18(20-11-14)23-9-7-22(8-10-23)13-17(25)15-12-21-24-6-2-1-3-16(15)24/h1-6,11-12H,7-10,13H2.
What are the key properties of 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone?
2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone has a molecular weight of 339.37 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-1-pyrazolo[1,5-a]pyridin-3-ylethanone is sourced from PubChem (CID 71601990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).