C18H20O3 — CID 71602021
methyl (1R,2S,3R,5S,7R,8S,9S)-5-phenyl-4-oxatetracyclo[5.4.0.02,5.03,9]undecane-8-carboxylate (PubChem CID 71602021) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is methyl (1R,2S,3R,5S,7R,8S,9S)-5-phenyl-4-oxatetracyclo[5.4.0.02,5.03,9]undecane-8-carboxylate.
| Compound Name | methyl (1R,2S,3R,5S,7R,8S,9S)-5-phenyl-4-oxatetracyclo[5.4.0.02,5.03,9]undecane-8-carboxylate |
|---|---|
| PubChem CID | 71602021 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | methyl (1R,2S,3R,5S,7R,8S,9S)-5-phenyl-4-oxatetracyclo[5.4.0.02,5.03,9]undecane-8-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2C[C@]3(c4ccccc4)O[C@@H]4[C@H]1CC[C@H]2[C@@H]43 |
| InChI | InChI=1S/C18H20O3/c1-20-17(19)14-12-8-7-11-13(14)9-18(15(11)16(12)21-18)10-5-3-2-4-6-10/h2-6,11-16H,7-9H2,1H3/t11-,12+,13-,14-,15+,16-,18-/m1/s1 |
| InChIKey | SFLJCOAOVQGIBC-NGJQAVAISA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |