C24H21F5N2O5 — CID 71602182
dimethyl (2S,10bS)-3-benzoyl-2-(1,1,2,2,2-pentafluoroethyl)-2,5,6,10b-tetrahydropyrazolo[5,1-a]isoquinoline-1,1-dicarboxylate (PubChem CID 71602182) has the molecular formula C24H21F5N2O5 and a molecular weight of 512.43 g/mol. Its IUPAC name is dimethyl (2S,10bS)-3-benzoyl-2-(1,1,2,2,2-pentafluoroethyl)-2,5,6,10b-tetrahydropyrazolo[5,1-a]isoquinoline-1,1-dicarboxylate.
| Compound Name | dimethyl (2S,10bS)-3-benzoyl-2-(1,1,2,2,2-pentafluoroethyl)-2,5,6,10b-tetrahydropyrazolo[5,1-a]isoquinoline-1,1-dicarboxylate |
|---|---|
| PubChem CID | 71602182 |
| Molecular Formula | C24H21F5N2O5 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | dimethyl (2S,10bS)-3-benzoyl-2-(1,1,2,2,2-pentafluoroethyl)-2,5,6,10b-tetrahydropyrazolo[5,1-a]isoquinoline-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)[C@@H]2c3ccccc3CCN2N(C(=O)c2ccccc2)[C@@H]1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H21F5N2O5/c1-35-20(33)22(21(34)36-2)17-16-11-7-6-8-14(16)12-13-30(17)31(18(32)15-9-4-3-5-10-15)19(22)23(25,26)24(27,28)29/h3-11,17,19H,12-13H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | DTIZJABXPZERBU-HKUYNNGSSA-N |
| XLogP | 3.56 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|