About N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride
N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride (PubChem CID 71602197) has the molecular formula C24H26Cl2N2
and a molecular weight of 413.39 g/mol. Its IUPAC name is N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride.
Molecular Properties
| Compound Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride |
| PubChem CID | 71602197 |
| Molecular Formula | C24H26Cl2N2 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride |
| SMILES | Cl.Clc1ccc(N(C[C@@H]2CNC[C@H]2Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25ClN2.ClH/c25-22-11-13-24(14-12-22)27(23-9-5-2-6-10-23)18-21-17-26-16-20(21)15-19-7-3-1-4-8-19;/h1-14,20-21,26H,15-18H2;1H/t20-,21+;/m1./s1 |
| InChIKey | MDIWHQTUADQJAY-BHDTVMLSSA-N |
| XLogP | 5.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride?
The IUPAC name of N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride (CID 71602197) is N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride.
What is the SMILES notation for N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride?
The canonical SMILES for N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride is Cl.Clc1ccc(N(C[C@@H]2CNC[C@H]2Cc2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride?
The InChIKey is MDIWHQTUADQJAY-BHDTVMLSSA-N. The full InChI is InChI=1S/C24H25ClN2.ClH/c25-22-11-13-24(14-12-22)27(23-9-5-2-6-10-23)18-21-17-26-16-20(21)15-19-7-3-1-4-8-19;/h1-14,20-21,26H,15-18H2;1H/t20-,21+;/m1./s1.
What are the key properties of N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride?
N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride has a molecular weight of 413.39 g/mol, XLogP of 5.98, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3S,4S)-4-benzylpyrrolidin-3-yl]methyl]-4-chloro-N-phenylaniline;hydrochloride is sourced from PubChem (CID 71602197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).