C22H18FNO5S — CID 71602249
2-[2-[4-[4-[(2-fluoroacetyl)amino]phenyl]phenyl]sulfonylphenyl]acetic acid (PubChem CID 71602249) has the molecular formula C22H18FNO5S and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[2-[4-[4-[(2-fluoroacetyl)amino]phenyl]phenyl]sulfonylphenyl]acetic acid.
| Compound Name | 2-[2-[4-[4-[(2-fluoroacetyl)amino]phenyl]phenyl]sulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 71602249 |
| Molecular Formula | C22H18FNO5S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-[2-[4-[4-[(2-fluoroacetyl)amino]phenyl]phenyl]sulfonylphenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1S(=O)(=O)c1ccc(-c2ccc(NC(=O)CF)cc2)cc1 |
| InChI | InChI=1S/C22H18FNO5S/c23-14-21(25)24-18-9-5-15(6-10-18)16-7-11-19(12-8-16)30(28,29)20-4-2-1-3-17(20)13-22(26)27/h1-12H,13-14H2,(H,24,25)(H,26,27) |
| InChIKey | CREFCFAJHQSGNR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |